C20H11BrN2O3 — CID 165437352
3-(6-bromo-1-benzofuran-3-yl)-4-(1H-indol-3-yl)pyrrole-2,5-dione (PubChem CID 165437352) has the molecular formula C20H11BrN2O3 and a molecular weight of 407.22 g/mol. Its IUPAC name is 3-(6-bromo-1-benzofuran-3-yl)-4-(1H-indol-3-yl)pyrrole-2,5-dione.
| Compound Name | 3-(6-bromo-1-benzofuran-3-yl)-4-(1H-indol-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 165437352 |
| Molecular Formula | C20H11BrN2O3 |
| Molecular Weight | 407.22 g/mol |
| Exact Mass | 406.00 |
| IUPAC Name | 3-(6-bromo-1-benzofuran-3-yl)-4-(1H-indol-3-yl)pyrrole-2,5-dione |
| SMILES | O=C1NC(=O)C(c2coc3cc(Br)ccc23)=C1c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C20H11BrN2O3/c21-10-5-6-12-14(9-26-16(12)7-10)18-17(19(24)23-20(18)25)13-8-22-15-4-2-1-3-11(13)15/h1-9,22H,(H,23,24,25) |
| InChIKey | GCLUGZOHGADXMQ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 75.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.22 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|