C32H30N4O3 — CID 11692096
3-[1-[3-(dimethylamino)propyl]indol-3-yl]-4-(5-phenylmethoxyindol-1-yl)pyrrole-2,5-dione (PubChem CID 11692096) has the molecular formula C32H30N4O3 and a molecular weight of 518.62 g/mol. Its IUPAC name is 3-[1-[3-(dimethylamino)propyl]indol-3-yl]-4-(5-phenylmethoxyindol-1-yl)pyrrole-2,5-dione.
| Compound Name | 3-[1-[3-(dimethylamino)propyl]indol-3-yl]-4-(5-phenylmethoxyindol-1-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 11692096 |
| Molecular Formula | C32H30N4O3 |
| Molecular Weight | 518.62 g/mol |
| Exact Mass | 518.23 |
| IUPAC Name | 3-[1-[3-(dimethylamino)propyl]indol-3-yl]-4-(5-phenylmethoxyindol-1-yl)pyrrole-2,5-dione |
| SMILES | CN(C)CCCn1cc(C2=C(n3ccc4cc(OCc5ccccc5)ccc43)C(=O)NC2=O)c2ccccc21 |
| InChI | InChI=1S/C32H30N4O3/c1-34(2)16-8-17-35-20-26(25-11-6-7-12-28(25)35)29-30(32(38)33-31(29)37)36-18-15-23-19-24(13-14-27(23)36)39-21-22-9-4-3-5-10-22/h3-7,9-15,18-20H,8,16-17,21H2,1-2H3,(H,33,37,38) |
| InChIKey | QGKAIXUWUICBEP-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 68.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.62 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|