C25H21Cl2N3O2S — CID 10368627
3-(2,5-dichloro-1-benzothiophen-3-yl)-4-[1-[3-(dimethylamino)propyl]indol-3-yl]pyrrole-2,5-dione (PubChem CID 10368627) has the molecular formula C25H21Cl2N3O2S and a molecular weight of 498.44 g/mol. Its IUPAC name is 3-(2,5-dichloro-1-benzothiophen-3-yl)-4-[1-[3-(dimethylamino)propyl]indol-3-yl]pyrrole-2,5-dione.
| Compound Name | 3-(2,5-dichloro-1-benzothiophen-3-yl)-4-[1-[3-(dimethylamino)propyl]indol-3-yl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 10368627 |
| Molecular Formula | C25H21Cl2N3O2S |
| Molecular Weight | 498.44 g/mol |
| Exact Mass | 497.07 |
| IUPAC Name | 3-(2,5-dichloro-1-benzothiophen-3-yl)-4-[1-[3-(dimethylamino)propyl]indol-3-yl]pyrrole-2,5-dione |
| SMILES | CN(C)CCCn1cc(C2=C(c3c(Cl)sc4ccc(Cl)cc34)C(=O)NC2=O)c2ccccc21 |
| InChI | InChI=1S/C25H21Cl2N3O2S/c1-29(2)10-5-11-30-13-17(15-6-3-4-7-18(15)30)21-22(25(32)28-24(21)31)20-16-12-14(26)8-9-19(16)33-23(20)27/h3-4,6-9,12-13H,5,10-11H2,1-2H3,(H,28,31,32) |
| InChIKey | NKNOLQIUDLQOLF-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.44 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|