C31H26N2O7S — CID 86602344
3-[3-[2,5-dioxo-4-(5-phenylmethoxy-1-benzofuran-7-yl)pyrrol-3-yl]indol-1-yl]propyl methanesulfonate (PubChem CID 86602344) has the molecular formula C31H26N2O7S and a molecular weight of 570.62 g/mol. Its IUPAC name is 3-[3-[2,5-dioxo-4-(5-phenylmethoxy-1-benzofuran-7-yl)pyrrol-3-yl]indol-1-yl]propyl methanesulfonate.
| Compound Name | 3-[3-[2,5-dioxo-4-(5-phenylmethoxy-1-benzofuran-7-yl)pyrrol-3-yl]indol-1-yl]propyl methanesulfonate |
|---|---|
| PubChem CID | 86602344 |
| Molecular Formula | C31H26N2O7S |
| Molecular Weight | 570.62 g/mol |
| Exact Mass | 570.15 |
| IUPAC Name | 3-[3-[2,5-dioxo-4-(5-phenylmethoxy-1-benzofuran-7-yl)pyrrol-3-yl]indol-1-yl]propyl methanesulfonate |
| SMILES | CS(=O)(=O)OCCCn1cc(C2=C(c3cc(OCc4ccccc4)cc4ccoc34)C(=O)NC2=O)c2ccccc21 |
| InChI | InChI=1S/C31H26N2O7S/c1-41(36,37)40-14-7-13-33-18-25(23-10-5-6-11-26(23)33)28-27(30(34)32-31(28)35)24-17-22(16-21-12-15-38-29(21)24)39-19-20-8-3-2-4-9-20/h2-6,8-12,15-18H,7,13-14,19H2,1H3,(H,32,34,35) |
| InChIKey | WOAFUZSJTPMAMP-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.62 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|