C23H21N3O4 — CID 71054630
5-[1-(2-hydroxyethyl)-5-methoxyindol-3-yl]-4-(1H-indol-3-yl)-6H-oxazin-3-one (PubChem CID 71054630) has the molecular formula C23H21N3O4 and a molecular weight of 403.44 g/mol. Its IUPAC name is 5-[1-(2-hydroxyethyl)-5-methoxyindol-3-yl]-4-(1H-indol-3-yl)-6H-oxazin-3-one.
| Compound Name | 5-[1-(2-hydroxyethyl)-5-methoxyindol-3-yl]-4-(1H-indol-3-yl)-6H-oxazin-3-one |
|---|---|
| PubChem CID | 71054630 |
| Molecular Formula | C23H21N3O4 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | 5-[1-(2-hydroxyethyl)-5-methoxyindol-3-yl]-4-(1H-indol-3-yl)-6H-oxazin-3-one |
| SMILES | COc1ccc2c(c1)c(C1=C(c3c[nH]c4ccccc34)C(=O)NOC1)cn2CCO |
| InChI | InChI=1S/C23H21N3O4/c1-29-14-6-7-21-16(10-14)18(12-26(21)8-9-27)19-13-30-25-23(28)22(19)17-11-24-20-5-3-2-4-15(17)20/h2-7,10-12,24,27H,8-9,13H2,1H3,(H,25,28) |
| InChIKey | PXKBPTXCLKBVET-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |