C17H24N4O2 — CID 94947311
5-amino-1-[3-(dimethylamino)propyl]-N,N-dimethyl-4-oxoquinoline-3-carboxamide (PubChem CID 94947311) has the molecular formula C17H24N4O2 and a molecular weight of 316.41 g/mol. Its IUPAC name is 5-amino-1-[3-(dimethylamino)propyl]-N,N-dimethyl-4-oxoquinoline-3-carboxamide.
| Compound Name | 5-amino-1-[3-(dimethylamino)propyl]-N,N-dimethyl-4-oxoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 94947311 |
| Molecular Formula | C17H24N4O2 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | 5-amino-1-[3-(dimethylamino)propyl]-N,N-dimethyl-4-oxoquinoline-3-carboxamide |
| SMILES | CN(C)CCCn1cc(C(=O)N(C)C)c(=O)c2c(N)cccc21 |
| InChI | InChI=1S/C17H24N4O2/c1-19(2)9-6-10-21-11-12(17(23)20(3)4)16(22)15-13(18)7-5-8-14(15)21/h5,7-8,11H,6,9-10,18H2,1-4H3 |
| InChIKey | LMUBWLHTXYJDMU-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 71.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|