C16H20N2O4 — CID 82212891
5-amino-4-oxo-1-(3-propan-2-yloxypropyl)quinoline-3-carboxylic acid (PubChem CID 82212891) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is 5-amino-4-oxo-1-(3-propan-2-yloxypropyl)quinoline-3-carboxylic acid.
| Compound Name | 5-amino-4-oxo-1-(3-propan-2-yloxypropyl)quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 82212891 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 5-amino-4-oxo-1-(3-propan-2-yloxypropyl)quinoline-3-carboxylic acid |
| SMILES | CC(C)OCCCn1cc(C(=O)O)c(=O)c2c(N)cccc21 |
| InChI | InChI=1S/C16H20N2O4/c1-10(2)22-8-4-7-18-9-11(16(20)21)15(19)14-12(17)5-3-6-13(14)18/h3,5-6,9-10H,4,7-8,17H2,1-2H3,(H,20,21) |
| InChIKey | RQURQBWAWCDTSV-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 94.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|