C15H22N2 — CID 158239004
3-(1-ethylindol-3-yl)-N,N-dimethylpropan-1-amine (PubChem CID 158239004) has the molecular formula C15H22N2 and a molecular weight of 230.35 g/mol. Its IUPAC name is 3-(1-ethylindol-3-yl)-N,N-dimethylpropan-1-amine.
| Compound Name | 3-(1-ethylindol-3-yl)-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 158239004 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 3-(1-ethylindol-3-yl)-N,N-dimethylpropan-1-amine |
| SMILES | CCn1cc(CCCN(C)C)c2ccccc21 |
| InChI | InChI=1S/C15H22N2/c1-4-17-12-13(8-7-11-16(2)3)14-9-5-6-10-15(14)17/h5-6,9-10,12H,4,7-8,11H2,1-3H3 |
| InChIKey | RUQIUMPMVKOJBM-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |