C15H22N2O2 — CID 166467492
2-(1-ethylindol-3-yl)-N,N-dimethylethanamine;formic acid (PubChem CID 166467492) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is 2-(1-ethylindol-3-yl)-N,N-dimethylethanamine;formic acid.
| Compound Name | 2-(1-ethylindol-3-yl)-N,N-dimethylethanamine;formic acid |
|---|---|
| PubChem CID | 166467492 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 2-(1-ethylindol-3-yl)-N,N-dimethylethanamine;formic acid |
| SMILES | CCn1cc(CCN(C)C)c2ccccc21.O=CO |
| InChI | InChI=1S/C14H20N2.CH2O2/c1-4-16-11-12(9-10-15(2)3)13-7-5-6-8-14(13)16;2-1-3/h5-8,11H,4,9-10H2,1-3H3;1H,(H,2,3) |
| InChIKey | XYIHVFQSFQYOHI-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|