2-(1-ethylindol-3-yl)-N,N-dimethylethanamine;formic acid

C15H22N2O2 — CID 166467492

IUPAC2-(1-ethylindol-3-yl)-N,N-dimethylethanamine;formic acid
SMILESCCn1cc(CCN(C)C)c2ccccc21.O=CO
InChIInChI=1S/C14H20N2.CH2O2/c1-4-16-11-12(9-10-15(2)3)13-7-5-6-8-14(13)16;2-1-3/h5-8,11H,4,9-10H2,1-3H3;1H,(H,2,3)
InChIKeyXYIHVFQSFQYOHI-UHFFFAOYSA-N
MW262.35 g/mol
LogP2.47
Rot. Bonds4

About 2-(1-ethylindol-3-yl)-N,N-dimethylethanamine;formic acid

2-(1-ethylindol-3-yl)-N,N-dimethylethanamine;formic acid (PubChem CID 166467492) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is 2-(1-ethylindol-3-yl)-N,N-dimethylethanamine;formic acid.

Molecular Properties

Compound Name2-(1-ethylindol-3-yl)-N,N-dimethylethanamine;formic acid
PubChem CID166467492
Molecular FormulaC15H22N2O2
Molecular Weight262.35 g/mol
Exact Mass262.17
IUPAC Name2-(1-ethylindol-3-yl)-N,N-dimethylethanamine;formic acid
SMILESCCn1cc(CCN(C)C)c2ccccc21.O=CO
InChIInChI=1S/C14H20N2.CH2O2/c1-4-16-11-12(9-10-15(2)3)13-7-5-6-8-14(13)16;2-1-3/h5-8,11H,4,9-10H2,1-3H3;1H,(H,2,3)
InChIKeyXYIHVFQSFQYOHI-UHFFFAOYSA-N
XLogP2.47
TPSA45.47 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500262.35
LogP ≤ 52.47
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}

Analyze 2-(1-ethylindol-3-yl)-N,N-dimethylethanamine;formic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1-ethylindol-3-yl)-N,N-dimethylethanamine;formic acid?
The IUPAC name of 2-(1-ethylindol-3-yl)-N,N-dimethylethanamine;formic acid (CID 166467492) is 2-(1-ethylindol-3-yl)-N,N-dimethylethanamine;formic acid.
What is the SMILES notation for 2-(1-ethylindol-3-yl)-N,N-dimethylethanamine;formic acid?
The canonical SMILES for 2-(1-ethylindol-3-yl)-N,N-dimethylethanamine;formic acid is CCn1cc(CCN(C)C)c2ccccc21.O=CO.
What is the InChIKey of 2-(1-ethylindol-3-yl)-N,N-dimethylethanamine;formic acid?
The InChIKey is XYIHVFQSFQYOHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2.CH2O2/c1-4-16-11-12(9-10-15(2)3)13-7-5-6-8-14(13)16;2-1-3/h5-8,11H,4,9-10H2,1-3H3;1H,(H,2,3).
What are the key properties of 2-(1-ethylindol-3-yl)-N,N-dimethylethanamine;formic acid?
2-(1-ethylindol-3-yl)-N,N-dimethylethanamine;formic acid has a molecular weight of 262.35 g/mol, XLogP of 2.47, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-ethylindol-3-yl)-N,N-dimethylethanamine;formic acid is sourced from PubChem (CID 166467492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).