C16H24ClN3O — CID 166467543
2-(dimethylamino)-1-[3-[2-(dimethylamino)ethyl]indol-1-yl]ethanone;hydrochloride (PubChem CID 166467543) has the molecular formula C16H24ClN3O and a molecular weight of 309.84 g/mol. Its IUPAC name is 2-(dimethylamino)-1-[3-[2-(dimethylamino)ethyl]indol-1-yl]ethanone;hydrochloride.
| Compound Name | 2-(dimethylamino)-1-[3-[2-(dimethylamino)ethyl]indol-1-yl]ethanone;hydrochloride |
|---|---|
| PubChem CID | 166467543 |
| Molecular Formula | C16H24ClN3O |
| Molecular Weight | 309.84 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | 2-(dimethylamino)-1-[3-[2-(dimethylamino)ethyl]indol-1-yl]ethanone;hydrochloride |
| SMILES | CN(C)CCc1cn(C(=O)CN(C)C)c2ccccc12.Cl |
| InChI | InChI=1S/C16H23N3O.ClH/c1-17(2)10-9-13-11-19(16(20)12-18(3)4)15-8-6-5-7-14(13)15;/h5-8,11H,9-10,12H2,1-4H3;1H |
| InChIKey | AEPMASHTYQSBOF-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 28.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.84 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |