C20H30N4O — CID 166467769
3-[2-(dimethylamino)ethyl]-N-[4-(methylamino)cyclohexyl]indole-1-carboxamide (PubChem CID 166467769) has the molecular formula C20H30N4O and a molecular weight of 342.49 g/mol. Its IUPAC name is 3-[2-(dimethylamino)ethyl]-N-[4-(methylamino)cyclohexyl]indole-1-carboxamide.
| Compound Name | 3-[2-(dimethylamino)ethyl]-N-[4-(methylamino)cyclohexyl]indole-1-carboxamide |
|---|---|
| PubChem CID | 166467769 |
| Molecular Formula | C20H30N4O |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.24 |
| IUPAC Name | 3-[2-(dimethylamino)ethyl]-N-[4-(methylamino)cyclohexyl]indole-1-carboxamide |
| SMILES | CNC1CCC(NC(=O)n2cc(CCN(C)C)c3ccccc32)CC1 |
| InChI | InChI=1S/C20H30N4O/c1-21-16-8-10-17(11-9-16)22-20(25)24-14-15(12-13-23(2)3)18-6-4-5-7-19(18)24/h4-7,14,16-17,21H,8-13H2,1-3H3,(H,22,25) |
| InChIKey | CJEGGXPZQDGDEG-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 49.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |