C23H34N4O2 — CID 168931076
N-[4-(azetidin-1-yl)cyclohexyl]-3-[2-(dimethylamino)ethyl]-6-methoxyindole-1-carboxamide (PubChem CID 168931076) has the molecular formula C23H34N4O2 and a molecular weight of 398.55 g/mol. Its IUPAC name is N-[4-(azetidin-1-yl)cyclohexyl]-3-[2-(dimethylamino)ethyl]-6-methoxyindole-1-carboxamide.
| Compound Name | N-[4-(azetidin-1-yl)cyclohexyl]-3-[2-(dimethylamino)ethyl]-6-methoxyindole-1-carboxamide |
|---|---|
| PubChem CID | 168931076 |
| Molecular Formula | C23H34N4O2 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.27 |
| IUPAC Name | N-[4-(azetidin-1-yl)cyclohexyl]-3-[2-(dimethylamino)ethyl]-6-methoxyindole-1-carboxamide |
| SMILES | COc1ccc2c(CCN(C)C)cn(C(=O)NC3CCC(N4CCC4)CC3)c2c1 |
| InChI | InChI=1S/C23H34N4O2/c1-25(2)14-11-17-16-27(22-15-20(29-3)9-10-21(17)22)23(28)24-18-5-7-19(8-6-18)26-12-4-13-26/h9-10,15-16,18-19H,4-8,11-14H2,1-3H3,(H,24,28) |
| InChIKey | VIZKMJKMAVSQQX-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 49.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |