C18H24N2O4 — CID 166467171
2-methylpropanoyloxymethyl 3-[2-(dimethylamino)ethyl]indole-1-carboxylate (PubChem CID 166467171) has the molecular formula C18H24N2O4 and a molecular weight of 332.40 g/mol. Its IUPAC name is 2-methylpropanoyloxymethyl 3-[2-(dimethylamino)ethyl]indole-1-carboxylate.
| Compound Name | 2-methylpropanoyloxymethyl 3-[2-(dimethylamino)ethyl]indole-1-carboxylate |
|---|---|
| PubChem CID | 166467171 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 2-methylpropanoyloxymethyl 3-[2-(dimethylamino)ethyl]indole-1-carboxylate |
| SMILES | CC(C)C(=O)OCOC(=O)n1cc(CCN(C)C)c2ccccc21 |
| InChI | InChI=1S/C18H24N2O4/c1-13(2)17(21)23-12-24-18(22)20-11-14(9-10-19(3)4)15-7-5-6-8-16(15)20/h5-8,11,13H,9-10,12H2,1-4H3 |
| InChIKey | ZFOBEQSOCFPHJX-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 60.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|