C20H22N2O8 — CID 166467519
(5-methyl-2-oxo-1,3-dioxol-4-yl)methoxycarbonyloxymethyl 3-[2-(dimethylamino)ethyl]indole-1-carboxylate (PubChem CID 166467519) has the molecular formula C20H22N2O8 and a molecular weight of 418.40 g/mol. Its IUPAC name is (5-methyl-2-oxo-1,3-dioxol-4-yl)methoxycarbonyloxymethyl 3-[2-(dimethylamino)ethyl]indole-1-carboxylate.
| Compound Name | (5-methyl-2-oxo-1,3-dioxol-4-yl)methoxycarbonyloxymethyl 3-[2-(dimethylamino)ethyl]indole-1-carboxylate |
|---|---|
| PubChem CID | 166467519 |
| Molecular Formula | C20H22N2O8 |
| Molecular Weight | 418.40 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | (5-methyl-2-oxo-1,3-dioxol-4-yl)methoxycarbonyloxymethyl 3-[2-(dimethylamino)ethyl]indole-1-carboxylate |
| SMILES | Cc1oc(=O)oc1COC(=O)OCOC(=O)n1cc(CCN(C)C)c2ccccc21 |
| InChI | InChI=1S/C20H22N2O8/c1-13-17(30-20(25)29-13)11-26-19(24)28-12-27-18(23)22-10-14(8-9-21(2)3)15-6-4-5-7-16(15)22/h4-7,10H,8-9,11-12H2,1-3H3 |
| InChIKey | HJSSNJYWUSOTQX-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 113.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.40 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|