C20H24N2O8 — CID 167307085
(2-hydroxy-5-methyl-1,3-dioxol-4-yl)methoxycarbonyloxymethyl 3-[2-(dimethylamino)ethyl]indole-1-carboxylate (PubChem CID 167307085) has the molecular formula C20H24N2O8 and a molecular weight of 420.42 g/mol. Its IUPAC name is (2-hydroxy-5-methyl-1,3-dioxol-4-yl)methoxycarbonyloxymethyl 3-[2-(dimethylamino)ethyl]indole-1-carboxylate.
| Compound Name | (2-hydroxy-5-methyl-1,3-dioxol-4-yl)methoxycarbonyloxymethyl 3-[2-(dimethylamino)ethyl]indole-1-carboxylate |
|---|---|
| PubChem CID | 167307085 |
| Molecular Formula | C20H24N2O8 |
| Molecular Weight | 420.42 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | (2-hydroxy-5-methyl-1,3-dioxol-4-yl)methoxycarbonyloxymethyl 3-[2-(dimethylamino)ethyl]indole-1-carboxylate |
| SMILES | CC1=C(COC(=O)OCOC(=O)n2cc(CCN(C)C)c3ccccc32)OC(O)O1 |
| InChI | InChI=1S/C20H24N2O8/c1-13-17(30-20(25)29-13)11-26-19(24)28-12-27-18(23)22-10-14(8-9-21(2)3)15-6-4-5-7-16(15)22/h4-7,10,20,25H,8-9,11-12H2,1-3H3 |
| InChIKey | PMFJJGJMGSJBQA-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 108.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.42 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|