C20H26N2O6 — CID 166467624
6-[[3-[2-(dimethylamino)ethyl]indole-1-carbonyl]oxymethoxy]-6-oxohexanoic acid (PubChem CID 166467624) has the molecular formula C20H26N2O6 and a molecular weight of 390.44 g/mol. Its IUPAC name is 6-[[3-[2-(dimethylamino)ethyl]indole-1-carbonyl]oxymethoxy]-6-oxohexanoic acid.
| Compound Name | 6-[[3-[2-(dimethylamino)ethyl]indole-1-carbonyl]oxymethoxy]-6-oxohexanoic acid |
|---|---|
| PubChem CID | 166467624 |
| Molecular Formula | C20H26N2O6 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 6-[[3-[2-(dimethylamino)ethyl]indole-1-carbonyl]oxymethoxy]-6-oxohexanoic acid |
| SMILES | CN(C)CCc1cn(C(=O)OCOC(=O)CCCCC(=O)O)c2ccccc12 |
| InChI | InChI=1S/C20H26N2O6/c1-21(2)12-11-15-13-22(17-8-4-3-7-16(15)17)20(26)28-14-27-19(25)10-6-5-9-18(23)24/h3-4,7-8,13H,5-6,9-12,14H2,1-2H3,(H,23,24) |
| InChIKey | XODVGWNMJITGEF-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|