C20H26N2O6 — CID 166467776
oxan-4-yloxycarbonyloxymethyl 3-[2-(dimethylamino)ethyl]indole-1-carboxylate (PubChem CID 166467776) has the molecular formula C20H26N2O6 and a molecular weight of 390.44 g/mol. Its IUPAC name is oxan-4-yloxycarbonyloxymethyl 3-[2-(dimethylamino)ethyl]indole-1-carboxylate.
| Compound Name | oxan-4-yloxycarbonyloxymethyl 3-[2-(dimethylamino)ethyl]indole-1-carboxylate |
|---|---|
| PubChem CID | 166467776 |
| Molecular Formula | C20H26N2O6 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | oxan-4-yloxycarbonyloxymethyl 3-[2-(dimethylamino)ethyl]indole-1-carboxylate |
| SMILES | CN(C)CCc1cn(C(=O)OCOC(=O)OC2CCOCC2)c2ccccc12 |
| InChI | InChI=1S/C20H26N2O6/c1-21(2)10-7-15-13-22(18-6-4-3-5-17(15)18)19(23)26-14-27-20(24)28-16-8-11-25-12-9-16/h3-6,13,16H,7-12,14H2,1-2H3 |
| InChIKey | TWABHZOQEXXNCS-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 79.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|