C25H43N3O3 — CID 166467522
butane;ethane;2-morpholin-4-ylethyl 3-[2-(dimethylamino)ethyl]indole-1-carboxylate (PubChem CID 166467522) has the molecular formula C25H43N3O3 and a molecular weight of 433.64 g/mol. Its IUPAC name is butane;ethane;2-morpholin-4-ylethyl 3-[2-(dimethylamino)ethyl]indole-1-carboxylate.
| Compound Name | butane;ethane;2-morpholin-4-ylethyl 3-[2-(dimethylamino)ethyl]indole-1-carboxylate |
|---|---|
| PubChem CID | 166467522 |
| Molecular Formula | C25H43N3O3 |
| Molecular Weight | 433.64 g/mol |
| Exact Mass | 433.33 |
| IUPAC Name | butane;ethane;2-morpholin-4-ylethyl 3-[2-(dimethylamino)ethyl]indole-1-carboxylate |
| SMILES | CC.CCCC.CN(C)CCc1cn(C(=O)OCCN2CCOCC2)c2ccccc12 |
| InChI | InChI=1S/C19H27N3O3.C4H10.C2H6/c1-20(2)8-7-16-15-22(18-6-4-3-5-17(16)18)19(23)25-14-11-21-9-12-24-13-10-21;1-3-4-2;1-2/h3-6,15H,7-14H2,1-2H3;3-4H2,1-2H3;1-2H3 |
| InChIKey | SKJAMDUCVXNDDR-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 46.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.64 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |