C17H22N2O3 — CID 166467362
methyl 4-[3-[2-(dimethylamino)ethyl]indol-1-yl]-4-oxobutanoate (PubChem CID 166467362) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is methyl 4-[3-[2-(dimethylamino)ethyl]indol-1-yl]-4-oxobutanoate.
| Compound Name | methyl 4-[3-[2-(dimethylamino)ethyl]indol-1-yl]-4-oxobutanoate |
|---|---|
| PubChem CID | 166467362 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | methyl 4-[3-[2-(dimethylamino)ethyl]indol-1-yl]-4-oxobutanoate |
| SMILES | COC(=O)CCC(=O)n1cc(CCN(C)C)c2ccccc21 |
| InChI | InChI=1S/C17H22N2O3/c1-18(2)11-10-13-12-19(15-7-5-4-6-14(13)15)16(20)8-9-17(21)22-3/h4-7,12H,8-11H2,1-3H3 |
| InChIKey | AGYHIISSZCOKDZ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |