C29H8Cl8N2O5 — CID 154629579
4,5,6,7-tetrachloro-2-[4-[4-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)benzoyl]phenyl]isoindole-1,3-dione (PubChem CID 154629579) has the molecular formula C29H8Cl8N2O5 and a molecular weight of 748.02 g/mol. Its IUPAC name is 4,5,6,7-tetrachloro-2-[4-[4-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)benzoyl]phenyl]isoindole-1,3-dione.
| Compound Name | 4,5,6,7-tetrachloro-2-[4-[4-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)benzoyl]phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 154629579 |
| Molecular Formula | C29H8Cl8N2O5 |
| Molecular Weight | 748.02 g/mol |
| Exact Mass | 743.79 |
| IUPAC Name | 4,5,6,7-tetrachloro-2-[4-[4-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)benzoyl]phenyl]isoindole-1,3-dione |
| SMILES | O=C(c1ccc(N2C(=O)c3c(Cl)c(Cl)c(Cl)c(Cl)c3C2=O)cc1)c1ccc(N2C(=O)c3c(Cl)c(Cl)c(Cl)c(Cl)c3C2=O)cc1 |
| InChI | InChI=1S/C29H8Cl8N2O5/c30-17-13-14(18(31)22(35)21(17)34)27(42)38(26(13)41)11-5-1-9(2-6-11)25(40)10-3-7-12(8-4-10)39-28(43)15-16(29(39)44)20(33)24(37)23(36)19(15)32/h1-8H |
| InChIKey | IOTZLQKZIDOGOM-UHFFFAOYSA-N |
| XLogP | 9.75 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.02 |
| LogP ≤ 5 | 9.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|