C26H22ClNO5 — CID 143626551
ethyl 2-[4-[4-chloro-1,3-dioxo-7-(phenylmethoxymethyl)isoindol-2-yl]phenyl]acetate (PubChem CID 143626551) has the molecular formula C26H22ClNO5 and a molecular weight of 463.92 g/mol. Its IUPAC name is ethyl 2-[4-[4-chloro-1,3-dioxo-7-(phenylmethoxymethyl)isoindol-2-yl]phenyl]acetate.
| Compound Name | ethyl 2-[4-[4-chloro-1,3-dioxo-7-(phenylmethoxymethyl)isoindol-2-yl]phenyl]acetate |
|---|---|
| PubChem CID | 143626551 |
| Molecular Formula | C26H22ClNO5 |
| Molecular Weight | 463.92 g/mol |
| Exact Mass | 463.12 |
| IUPAC Name | ethyl 2-[4-[4-chloro-1,3-dioxo-7-(phenylmethoxymethyl)isoindol-2-yl]phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(N2C(=O)c3c(Cl)ccc(COCc4ccccc4)c3C2=O)cc1 |
| InChI | InChI=1S/C26H22ClNO5/c1-2-33-22(29)14-17-8-11-20(12-9-17)28-25(30)23-19(10-13-21(27)24(23)26(28)31)16-32-15-18-6-4-3-5-7-18/h3-13H,2,14-16H2,1H3 |
| InChIKey | LVSHWQRKAGCFSA-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.92 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|