C25H22ClNO5 — CID 59549944
ethyl 2-[4-(4-chloro-1-hydroxy-3-oxo-7-phenylmethoxy-1H-isoindol-2-yl)phenyl]acetate (PubChem CID 59549944) has the molecular formula C25H22ClNO5 and a molecular weight of 451.91 g/mol. Its IUPAC name is ethyl 2-[4-(4-chloro-1-hydroxy-3-oxo-7-phenylmethoxy-1H-isoindol-2-yl)phenyl]acetate.
| Compound Name | ethyl 2-[4-(4-chloro-1-hydroxy-3-oxo-7-phenylmethoxy-1H-isoindol-2-yl)phenyl]acetate |
|---|---|
| PubChem CID | 59549944 |
| Molecular Formula | C25H22ClNO5 |
| Molecular Weight | 451.91 g/mol |
| Exact Mass | 451.12 |
| IUPAC Name | ethyl 2-[4-(4-chloro-1-hydroxy-3-oxo-7-phenylmethoxy-1H-isoindol-2-yl)phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(N2C(=O)c3c(Cl)ccc(OCc4ccccc4)c3C2O)cc1 |
| InChI | InChI=1S/C25H22ClNO5/c1-2-31-21(28)14-16-8-10-18(11-9-16)27-24(29)22-19(26)12-13-20(23(22)25(27)30)32-15-17-6-4-3-5-7-17/h3-13,25,30H,2,14-15H2,1H3 |
| InChIKey | ZJWMDQLSWQWZRC-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.91 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |