C28H24ClNO6 — CID 108677917
ethyl 2-[4-[(4Z)-4-[(3-chloro-4-methoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-phenylpyrrolidin-1-yl]phenyl]acetate (PubChem CID 108677917) has the molecular formula C28H24ClNO6 and a molecular weight of 505.95 g/mol. Its IUPAC name is ethyl 2-[4-[(4Z)-4-[(3-chloro-4-methoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-phenylpyrrolidin-1-yl]phenyl]acetate.
| Compound Name | ethyl 2-[4-[(4Z)-4-[(3-chloro-4-methoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-phenylpyrrolidin-1-yl]phenyl]acetate |
|---|---|
| PubChem CID | 108677917 |
| Molecular Formula | C28H24ClNO6 |
| Molecular Weight | 505.95 g/mol |
| Exact Mass | 505.13 |
| IUPAC Name | ethyl 2-[4-[(4Z)-4-[(3-chloro-4-methoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-phenylpyrrolidin-1-yl]phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(N2C(=O)C(=O)/C(=C(\O)c3ccc(OC)c(Cl)c3)C2c2ccccc2)cc1 |
| InChI | InChI=1S/C28H24ClNO6/c1-3-36-23(31)15-17-9-12-20(13-10-17)30-25(18-7-5-4-6-8-18)24(27(33)28(30)34)26(32)19-11-14-22(35-2)21(29)16-19/h4-14,16,25,32H,3,15H2,1-2H3/b26-24- |
| InChIKey | MQNLXGRBUUGINC-LCUIJRPUSA-N |
| XLogP | 5.08 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.95 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|