C28H25ClN2O7 — CID 108673907
ethyl 2-[4-[(4E)-4-[(5-chloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-4-ylpyrrolidin-1-yl]phenyl]acetate (PubChem CID 108673907) has the molecular formula C28H25ClN2O7 and a molecular weight of 536.97 g/mol. Its IUPAC name is ethyl 2-[4-[(4E)-4-[(5-chloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-4-ylpyrrolidin-1-yl]phenyl]acetate.
| Compound Name | ethyl 2-[4-[(4E)-4-[(5-chloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-4-ylpyrrolidin-1-yl]phenyl]acetate |
|---|---|
| PubChem CID | 108673907 |
| Molecular Formula | C28H25ClN2O7 |
| Molecular Weight | 536.97 g/mol |
| Exact Mass | 536.14 |
| IUPAC Name | ethyl 2-[4-[(4E)-4-[(5-chloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-4-ylpyrrolidin-1-yl]phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(N2C(=O)C(=O)/C(=C(/O)c3cc(Cl)c(OC)cc3OC)C2c2ccncc2)cc1 |
| InChI | InChI=1S/C28H25ClN2O7/c1-4-38-23(32)13-16-5-7-18(8-6-16)31-25(17-9-11-30-12-10-17)24(27(34)28(31)35)26(33)19-14-20(29)22(37-3)15-21(19)36-2/h5-12,14-15,25,33H,4,13H2,1-3H3/b26-24+ |
| InChIKey | JKRXPAWPQKPLIT-SHHOIMCASA-N |
| XLogP | 4.48 |
| TPSA | 115.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.97 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|