C29H27ClN2O7 — CID 108724317
propan-2-yl 2-[4-[(4E)-4-[(4-chloro-2,5-dimethoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-3-ylpyrrolidin-1-yl]phenyl]acetate (PubChem CID 108724317) has the molecular formula C29H27ClN2O7 and a molecular weight of 551.00 g/mol. Its IUPAC name is propan-2-yl 2-[4-[(4E)-4-[(4-chloro-2,5-dimethoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-3-ylpyrrolidin-1-yl]phenyl]acetate.
| Compound Name | propan-2-yl 2-[4-[(4E)-4-[(4-chloro-2,5-dimethoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-3-ylpyrrolidin-1-yl]phenyl]acetate |
|---|---|
| PubChem CID | 108724317 |
| Molecular Formula | C29H27ClN2O7 |
| Molecular Weight | 551.00 g/mol |
| Exact Mass | 550.15 |
| IUPAC Name | propan-2-yl 2-[4-[(4E)-4-[(4-chloro-2,5-dimethoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-3-ylpyrrolidin-1-yl]phenyl]acetate |
| SMILES | COc1cc(/C(O)=C2\C(=O)C(=O)N(c3ccc(CC(=O)OC(C)C)cc3)C2c2cccnc2)c(OC)cc1Cl |
| InChI | InChI=1S/C29H27ClN2O7/c1-16(2)39-24(33)12-17-7-9-19(10-8-17)32-26(18-6-5-11-31-15-18)25(28(35)29(32)36)27(34)20-13-23(38-4)21(30)14-22(20)37-3/h5-11,13-16,26,34H,12H2,1-4H3/b27-25+ |
| InChIKey | RLGVHCMPQFYDIL-IMVLJIQESA-N |
| XLogP | 4.87 |
| TPSA | 115.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.00 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|