C31H30ClNO7 — CID 108718352
2-[4-[(3E)-2-(4-tert-butylphenyl)-3-[(4-chloro-2,5-dimethoxyphenyl)-hydroxymethylidene]-4,5-dioxopyrrolidin-1-yl]phenyl]acetic acid (PubChem CID 108718352) has the molecular formula C31H30ClNO7 and a molecular weight of 564.03 g/mol. Its IUPAC name is 2-[4-[(3E)-2-(4-tert-butylphenyl)-3-[(4-chloro-2,5-dimethoxyphenyl)-hydroxymethylidene]-4,5-dioxopyrrolidin-1-yl]phenyl]acetic acid.
| Compound Name | 2-[4-[(3E)-2-(4-tert-butylphenyl)-3-[(4-chloro-2,5-dimethoxyphenyl)-hydroxymethylidene]-4,5-dioxopyrrolidin-1-yl]phenyl]acetic acid |
|---|---|
| PubChem CID | 108718352 |
| Molecular Formula | C31H30ClNO7 |
| Molecular Weight | 564.03 g/mol |
| Exact Mass | 563.17 |
| IUPAC Name | 2-[4-[(3E)-2-(4-tert-butylphenyl)-3-[(4-chloro-2,5-dimethoxyphenyl)-hydroxymethylidene]-4,5-dioxopyrrolidin-1-yl]phenyl]acetic acid |
| SMILES | COc1cc(/C(O)=C2\C(=O)C(=O)N(c3ccc(CC(=O)O)cc3)C2c2ccc(C(C)(C)C)cc2)c(OC)cc1Cl |
| InChI | InChI=1S/C31H30ClNO7/c1-31(2,3)19-10-8-18(9-11-19)27-26(28(36)21-15-24(40-5)22(32)16-23(21)39-4)29(37)30(38)33(27)20-12-6-17(7-13-20)14-25(34)35/h6-13,15-16,27,36H,14H2,1-5H3,(H,34,35)/b28-26+ |
| InChIKey | CSYRKBZTPYJUMN-BYCLXTJYSA-N |
| XLogP | 5.91 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.03 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|