C32H34ClNO6 — CID 108719134
(4E)-5-(4-tert-butylphenyl)-4-[(4-chloro-2,5-dimethoxyphenyl)-hydroxymethylidene]-1-[2-(4-methoxyphenyl)ethyl]pyrrolidine-2,3-dione (PubChem CID 108719134) has the molecular formula C32H34ClNO6 and a molecular weight of 564.08 g/mol. Its IUPAC name is (4E)-5-(4-tert-butylphenyl)-4-[(4-chloro-2,5-dimethoxyphenyl)-hydroxymethylidene]-1-[2-(4-methoxyphenyl)ethyl]pyrrolidine-2,3-dione.
| Compound Name | (4E)-5-(4-tert-butylphenyl)-4-[(4-chloro-2,5-dimethoxyphenyl)-hydroxymethylidene]-1-[2-(4-methoxyphenyl)ethyl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108719134 |
| Molecular Formula | C32H34ClNO6 |
| Molecular Weight | 564.08 g/mol |
| Exact Mass | 563.21 |
| IUPAC Name | (4E)-5-(4-tert-butylphenyl)-4-[(4-chloro-2,5-dimethoxyphenyl)-hydroxymethylidene]-1-[2-(4-methoxyphenyl)ethyl]pyrrolidine-2,3-dione |
| SMILES | COc1ccc(CCN2C(=O)C(=O)/C(=C(/O)c3cc(OC)c(Cl)cc3OC)C2c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C32H34ClNO6/c1-32(2,3)21-11-9-20(10-12-21)28-27(29(35)23-17-26(40-6)24(33)18-25(23)39-5)30(36)31(37)34(28)16-15-19-7-13-22(38-4)14-8-19/h7-14,17-18,28,35H,15-16H2,1-6H3/b29-27+ |
| InChIKey | YINAGZYSARMYES-ORIPQNMZSA-N |
| XLogP | 6.33 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.08 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|