C30H30BrNO4 — CID 108719148
(4Z)-4-[(4-bromophenyl)-hydroxymethylidene]-5-(4-tert-butylphenyl)-1-[2-(4-methoxyphenyl)ethyl]pyrrolidine-2,3-dione (PubChem CID 108719148) has the molecular formula C30H30BrNO4 and a molecular weight of 548.48 g/mol. Its IUPAC name is (4Z)-4-[(4-bromophenyl)-hydroxymethylidene]-5-(4-tert-butylphenyl)-1-[2-(4-methoxyphenyl)ethyl]pyrrolidine-2,3-dione.
| Compound Name | (4Z)-4-[(4-bromophenyl)-hydroxymethylidene]-5-(4-tert-butylphenyl)-1-[2-(4-methoxyphenyl)ethyl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108719148 |
| Molecular Formula | C30H30BrNO4 |
| Molecular Weight | 548.48 g/mol |
| Exact Mass | 547.14 |
| IUPAC Name | (4Z)-4-[(4-bromophenyl)-hydroxymethylidene]-5-(4-tert-butylphenyl)-1-[2-(4-methoxyphenyl)ethyl]pyrrolidine-2,3-dione |
| SMILES | COc1ccc(CCN2C(=O)C(=O)/C(=C(\O)c3ccc(Br)cc3)C2c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C30H30BrNO4/c1-30(2,3)22-11-7-20(8-12-22)26-25(27(33)21-9-13-23(31)14-10-21)28(34)29(35)32(26)18-17-19-5-15-24(36-4)16-6-19/h5-16,26,33H,17-18H2,1-4H3/b27-25- |
| InChIKey | QSTCMZNYQYCDDS-RFBIWTDZSA-N |
| XLogP | 6.42 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.48 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|