C29H29BrN2O5S — CID 124891337
4-[2-[(2R)-3-[(4-bromophenyl)-hydroxymethylidene]-2-(4-tert-butylphenyl)-4,5-dioxopyrrolidin-1-yl]ethyl]benzenesulfonamide (PubChem CID 124891337) has the molecular formula C29H29BrN2O5S and a molecular weight of 597.53 g/mol. Its IUPAC name is 4-[2-[(2R)-3-[(4-bromophenyl)-hydroxymethylidene]-2-(4-tert-butylphenyl)-4,5-dioxopyrrolidin-1-yl]ethyl]benzenesulfonamide.
| Compound Name | 4-[2-[(2R)-3-[(4-bromophenyl)-hydroxymethylidene]-2-(4-tert-butylphenyl)-4,5-dioxopyrrolidin-1-yl]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 124891337 |
| Molecular Formula | C29H29BrN2O5S |
| Molecular Weight | 597.53 g/mol |
| Exact Mass | 596.10 |
| IUPAC Name | 4-[2-[(2R)-3-[(4-bromophenyl)-hydroxymethylidene]-2-(4-tert-butylphenyl)-4,5-dioxopyrrolidin-1-yl]ethyl]benzenesulfonamide |
| SMILES | CC(C)(C)c1ccc([C@@H]2C(=C(O)c3ccc(Br)cc3)C(=O)C(=O)N2CCc2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C29H29BrN2O5S/c1-29(2,3)21-10-6-19(7-11-21)25-24(26(33)20-8-12-22(30)13-9-20)27(34)28(35)32(25)17-16-18-4-14-23(15-5-18)38(31,36)37/h4-15,25,33H,16-17H2,1-3H3,(H2,31,36,37)/t25-/m1/s1 |
| InChIKey | UGAANUHMSDMBAI-RUZDIDTESA-N |
| XLogP | 5.06 |
| TPSA | 117.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.53 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|