C33H34FNO3 — CID 108719402
(4Z)-5-(4-tert-butylphenyl)-1-[2-(4-fluorophenyl)ethyl]-4-[hydroxy(5,6,7,8-tetrahydronaphthalen-2-yl)methylidene]pyrrolidine-2,3-dione (PubChem CID 108719402) has the molecular formula C33H34FNO3 and a molecular weight of 511.64 g/mol. Its IUPAC name is (4Z)-5-(4-tert-butylphenyl)-1-[2-(4-fluorophenyl)ethyl]-4-[hydroxy(5,6,7,8-tetrahydronaphthalen-2-yl)methylidene]pyrrolidine-2,3-dione.
| Compound Name | (4Z)-5-(4-tert-butylphenyl)-1-[2-(4-fluorophenyl)ethyl]-4-[hydroxy(5,6,7,8-tetrahydronaphthalen-2-yl)methylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108719402 |
| Molecular Formula | C33H34FNO3 |
| Molecular Weight | 511.64 g/mol |
| Exact Mass | 511.25 |
| IUPAC Name | (4Z)-5-(4-tert-butylphenyl)-1-[2-(4-fluorophenyl)ethyl]-4-[hydroxy(5,6,7,8-tetrahydronaphthalen-2-yl)methylidene]pyrrolidine-2,3-dione |
| SMILES | CC(C)(C)c1ccc(C2/C(=C(/O)c3ccc4c(c3)CCCC4)C(=O)C(=O)N2CCc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C33H34FNO3/c1-33(2,3)26-14-12-23(13-15-26)29-28(30(36)25-11-10-22-6-4-5-7-24(22)20-25)31(37)32(38)35(29)19-18-21-8-16-27(34)17-9-21/h8-17,20,29,36H,4-7,18-19H2,1-3H3/b30-28- |
| InChIKey | INRTUOWGRDDVIP-HYOGKJQXSA-N |
| XLogP | 6.67 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.64 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|