C26H21Cl2NO5 — CID 143626548
ethyl 2-[3-chloro-4-[4-chloro-7-[(2-methylphenyl)methoxy]-1,3-dioxoisoindol-2-yl]phenyl]acetate (PubChem CID 143626548) has the molecular formula C26H21Cl2NO5 and a molecular weight of 498.36 g/mol. Its IUPAC name is ethyl 2-[3-chloro-4-[4-chloro-7-[(2-methylphenyl)methoxy]-1,3-dioxoisoindol-2-yl]phenyl]acetate.
| Compound Name | ethyl 2-[3-chloro-4-[4-chloro-7-[(2-methylphenyl)methoxy]-1,3-dioxoisoindol-2-yl]phenyl]acetate |
|---|---|
| PubChem CID | 143626548 |
| Molecular Formula | C26H21Cl2NO5 |
| Molecular Weight | 498.36 g/mol |
| Exact Mass | 497.08 |
| IUPAC Name | ethyl 2-[3-chloro-4-[4-chloro-7-[(2-methylphenyl)methoxy]-1,3-dioxoisoindol-2-yl]phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(N2C(=O)c3c(Cl)ccc(OCc4ccccc4C)c3C2=O)c(Cl)c1 |
| InChI | InChI=1S/C26H21Cl2NO5/c1-3-33-22(30)13-16-8-10-20(19(28)12-16)29-25(31)23-18(27)9-11-21(24(23)26(29)32)34-14-17-7-5-4-6-15(17)2/h4-12H,3,13-14H2,1-2H3 |
| InChIKey | AHEUCBRKTTWFSS-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.36 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|