C26H20Cl2FNO4 — CID 71125436
ethyl 2-[4-[4-chloro-7-[2-(3-chlorophenyl)ethyl]-1,3-dioxoisoindol-2-yl]-3-fluorophenyl]acetate (PubChem CID 71125436) has the molecular formula C26H20Cl2FNO4 and a molecular weight of 500.35 g/mol. Its IUPAC name is ethyl 2-[4-[4-chloro-7-[2-(3-chlorophenyl)ethyl]-1,3-dioxoisoindol-2-yl]-3-fluorophenyl]acetate.
| Compound Name | ethyl 2-[4-[4-chloro-7-[2-(3-chlorophenyl)ethyl]-1,3-dioxoisoindol-2-yl]-3-fluorophenyl]acetate |
|---|---|
| PubChem CID | 71125436 |
| Molecular Formula | C26H20Cl2FNO4 |
| Molecular Weight | 500.35 g/mol |
| Exact Mass | 499.08 |
| IUPAC Name | ethyl 2-[4-[4-chloro-7-[2-(3-chlorophenyl)ethyl]-1,3-dioxoisoindol-2-yl]-3-fluorophenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(N2C(=O)c3c(Cl)ccc(CCc4cccc(Cl)c4)c3C2=O)c(F)c1 |
| InChI | InChI=1S/C26H20Cl2FNO4/c1-2-34-22(31)14-16-7-11-21(20(29)13-16)30-25(32)23-17(9-10-19(28)24(23)26(30)33)8-6-15-4-3-5-18(27)12-15/h3-5,7,9-13H,2,6,8,14H2,1H3 |
| InChIKey | WHDLZNVDBYAYEZ-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.35 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|