C26H20ClF4NO6 — CID 25179836
ethyl 2-[4-[4,9-bis(2,2-difluoroethoxy)-1,3-dioxobenzo[f]isoindol-2-yl]-3-chlorophenyl]acetate (PubChem CID 25179836) has the molecular formula C26H20ClF4NO6 and a molecular weight of 553.89 g/mol. Its IUPAC name is ethyl 2-[4-[4,9-bis(2,2-difluoroethoxy)-1,3-dioxobenzo[f]isoindol-2-yl]-3-chlorophenyl]acetate.
| Compound Name | ethyl 2-[4-[4,9-bis(2,2-difluoroethoxy)-1,3-dioxobenzo[f]isoindol-2-yl]-3-chlorophenyl]acetate |
|---|---|
| PubChem CID | 25179836 |
| Molecular Formula | C26H20ClF4NO6 |
| Molecular Weight | 553.89 g/mol |
| Exact Mass | 553.09 |
| IUPAC Name | ethyl 2-[4-[4,9-bis(2,2-difluoroethoxy)-1,3-dioxobenzo[f]isoindol-2-yl]-3-chlorophenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(N2C(=O)c3c(c(OCC(F)F)c4ccccc4c3OCC(F)F)C2=O)c(Cl)c1 |
| InChI | InChI=1S/C26H20ClF4NO6/c1-2-36-20(33)10-13-7-8-17(16(27)9-13)32-25(34)21-22(26(32)35)24(38-12-19(30)31)15-6-4-3-5-14(15)23(21)37-11-18(28)29/h3-9,18-19H,2,10-12H2,1H3 |
| InChIKey | XGUKZBJAFCMFHY-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.89 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|