C34H41NO6 — CID 91084110
ethyl 2-[4-(4,9-dihexoxy-1,3-dioxobenzo[f]isoindol-2-yl)phenyl]acetate (PubChem CID 91084110) has the molecular formula C34H41NO6 and a molecular weight of 559.70 g/mol. Its IUPAC name is ethyl 2-[4-(4,9-dihexoxy-1,3-dioxobenzo[f]isoindol-2-yl)phenyl]acetate.
| Compound Name | ethyl 2-[4-(4,9-dihexoxy-1,3-dioxobenzo[f]isoindol-2-yl)phenyl]acetate |
|---|---|
| PubChem CID | 91084110 |
| Molecular Formula | C34H41NO6 |
| Molecular Weight | 559.70 g/mol |
| Exact Mass | 559.29 |
| IUPAC Name | ethyl 2-[4-(4,9-dihexoxy-1,3-dioxobenzo[f]isoindol-2-yl)phenyl]acetate |
| SMILES | CCCCCCOc1c2c(c(OCCCCCC)c3ccccc13)C(=O)N(c1ccc(CC(=O)OCC)cc1)C2=O |
| InChI | InChI=1S/C34H41NO6/c1-4-7-9-13-21-40-31-26-15-11-12-16-27(26)32(41-22-14-10-8-5-2)30-29(31)33(37)35(34(30)38)25-19-17-24(18-20-25)23-28(36)39-6-3/h11-12,15-20H,4-10,13-14,21-23H2,1-3H3 |
| InChIKey | XCJDSVDJLLGUKC-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.70 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|