About 2-[4-(4,9-dihexoxy-3-oxo-1H-benzo[f]isoindol-2-yl)phenyl]acetate
2-[4-(4,9-dihexoxy-3-oxo-1H-benzo[f]isoindol-2-yl)phenyl]acetate (PubChem CID 21079339) has the molecular formula C32H38NO5-
and a molecular weight of 516.66 g/mol. Its IUPAC name is 2-[4-(4,9-dihexoxy-3-oxo-1H-benzo[f]isoindol-2-yl)phenyl]acetate.
Molecular Properties
| Compound Name | 2-[4-(4,9-dihexoxy-3-oxo-1H-benzo[f]isoindol-2-yl)phenyl]acetate |
| PubChem CID | 21079339 |
| Molecular Formula | C32H38NO5- |
| Molecular Weight | 516.66 g/mol |
| Exact Mass | 516.28 |
| IUPAC Name | 2-[4-(4,9-dihexoxy-3-oxo-1H-benzo[f]isoindol-2-yl)phenyl]acetate |
| SMILES | CCCCCCOc1c2c(c(OCCCCCC)c3ccccc13)C(=O)N(c1ccc(CC(=O)[O-])cc1)C2 |
| InChI | InChI=1S/C32H39NO5/c1-3-5-7-11-19-37-30-25-13-9-10-14-26(25)31(38-20-12-8-6-4-2)29-27(30)22-33(32(29)36)24-17-15-23(16-18-24)21-28(34)35/h9-10,13-18H,3-8,11-12,19-22H2,1-2H3,(H,34,35)/p-1 |
| InChIKey | DKAJTTJQVGYKHG-UHFFFAOYSA-M |
| XLogP | 6.21 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 516.66 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(4,9-dihexoxy-3-oxo-1H-benzo[f]isoindol-2-yl)phenyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(4,9-dihexoxy-3-oxo-1H-benzo[f]isoindol-2-yl)phenyl]acetate?
The IUPAC name of 2-[4-(4,9-dihexoxy-3-oxo-1H-benzo[f]isoindol-2-yl)phenyl]acetate (CID 21079339) is 2-[4-(4,9-dihexoxy-3-oxo-1H-benzo[f]isoindol-2-yl)phenyl]acetate.
What is the SMILES notation for 2-[4-(4,9-dihexoxy-3-oxo-1H-benzo[f]isoindol-2-yl)phenyl]acetate?
The canonical SMILES for 2-[4-(4,9-dihexoxy-3-oxo-1H-benzo[f]isoindol-2-yl)phenyl]acetate is CCCCCCOc1c2c(c(OCCCCCC)c3ccccc13)C(=O)N(c1ccc(CC(=O)[O-])cc1)C2.
What is the InChIKey of 2-[4-(4,9-dihexoxy-3-oxo-1H-benzo[f]isoindol-2-yl)phenyl]acetate?
The InChIKey is DKAJTTJQVGYKHG-UHFFFAOYSA-M. The full InChI is InChI=1S/C32H39NO5/c1-3-5-7-11-19-37-30-25-13-9-10-14-26(25)31(38-20-12-8-6-4-2)29-27(30)22-33(32(29)36)24-17-15-23(16-18-24)21-28(34)35/h9-10,13-18H,3-8,11-12,19-22H2,1-2H3,(H,34,35)/p-1.
What are the key properties of 2-[4-(4,9-dihexoxy-3-oxo-1H-benzo[f]isoindol-2-yl)phenyl]acetate?
2-[4-(4,9-dihexoxy-3-oxo-1H-benzo[f]isoindol-2-yl)phenyl]acetate has a molecular weight of 516.66 g/mol, XLogP of 6.21, 15 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(4,9-dihexoxy-3-oxo-1H-benzo[f]isoindol-2-yl)phenyl]acetate is sourced from PubChem (CID 21079339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).