C29H32NO5- — CID 21079348
2-[4-(9-hexoxy-3-oxo-4-propan-2-yloxy-1H-benzo[f]isoindol-2-yl)phenyl]acetate (PubChem CID 21079348) has the molecular formula C29H32NO5- and a molecular weight of 474.58 g/mol. Its IUPAC name is 2-[4-(9-hexoxy-3-oxo-4-propan-2-yloxy-1H-benzo[f]isoindol-2-yl)phenyl]acetate.
| Compound Name | 2-[4-(9-hexoxy-3-oxo-4-propan-2-yloxy-1H-benzo[f]isoindol-2-yl)phenyl]acetate |
|---|---|
| PubChem CID | 21079348 |
| Molecular Formula | C29H32NO5- |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | 2-[4-(9-hexoxy-3-oxo-4-propan-2-yloxy-1H-benzo[f]isoindol-2-yl)phenyl]acetate |
| SMILES | CCCCCCOc1c2c(c(OC(C)C)c3ccccc13)C(=O)N(c1ccc(CC(=O)[O-])cc1)C2 |
| InChI | InChI=1S/C29H33NO5/c1-4-5-6-9-16-34-27-22-10-7-8-11-23(22)28(35-19(2)3)26-24(27)18-30(29(26)33)21-14-12-20(13-15-21)17-25(31)32/h7-8,10-15,19H,4-6,9,16-18H2,1-3H3,(H,31,32)/p-1 |
| InChIKey | CDNPPHDXOVQFRY-UHFFFAOYSA-M |
| XLogP | 5.04 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|