About 2-[4-(9-hexoxy-1,3-dioxo-4-propan-2-yloxybenzo[f]isoindol-2-yl)phenyl]acetic acid
2-[4-(9-hexoxy-1,3-dioxo-4-propan-2-yloxybenzo[f]isoindol-2-yl)phenyl]acetic acid (PubChem CID 21079347) has the molecular formula C29H31NO6
and a molecular weight of 489.57 g/mol. Its IUPAC name is 2-[4-(9-hexoxy-1,3-dioxo-4-propan-2-yloxybenzo[f]isoindol-2-yl)phenyl]acetic acid.
Molecular Properties
| Compound Name | 2-[4-(9-hexoxy-1,3-dioxo-4-propan-2-yloxybenzo[f]isoindol-2-yl)phenyl]acetic acid |
| PubChem CID | 21079347 |
| Molecular Formula | C29H31NO6 |
| Molecular Weight | 489.57 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | 2-[4-(9-hexoxy-1,3-dioxo-4-propan-2-yloxybenzo[f]isoindol-2-yl)phenyl]acetic acid |
| SMILES | CCCCCCOc1c2c(c(OC(C)C)c3ccccc13)C(=O)N(c1ccc(CC(=O)O)cc1)C2=O |
| InChI | InChI=1S/C29H31NO6/c1-4-5-6-9-16-35-26-21-10-7-8-11-22(21)27(36-18(2)3)25-24(26)28(33)30(29(25)34)20-14-12-19(13-15-20)17-23(31)32/h7-8,10-15,18H,4-6,9,16-17H2,1-3H3,(H,31,32) |
| InChIKey | IUVGJYGZNXUZGN-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 489.57 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(9-hexoxy-1,3-dioxo-4-propan-2-yloxybenzo[f]isoindol-2-yl)phenyl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(9-hexoxy-1,3-dioxo-4-propan-2-yloxybenzo[f]isoindol-2-yl)phenyl]acetic acid?
The IUPAC name of 2-[4-(9-hexoxy-1,3-dioxo-4-propan-2-yloxybenzo[f]isoindol-2-yl)phenyl]acetic acid (CID 21079347) is 2-[4-(9-hexoxy-1,3-dioxo-4-propan-2-yloxybenzo[f]isoindol-2-yl)phenyl]acetic acid.
What is the SMILES notation for 2-[4-(9-hexoxy-1,3-dioxo-4-propan-2-yloxybenzo[f]isoindol-2-yl)phenyl]acetic acid?
The canonical SMILES for 2-[4-(9-hexoxy-1,3-dioxo-4-propan-2-yloxybenzo[f]isoindol-2-yl)phenyl]acetic acid is CCCCCCOc1c2c(c(OC(C)C)c3ccccc13)C(=O)N(c1ccc(CC(=O)O)cc1)C2=O.
What is the InChIKey of 2-[4-(9-hexoxy-1,3-dioxo-4-propan-2-yloxybenzo[f]isoindol-2-yl)phenyl]acetic acid?
The InChIKey is IUVGJYGZNXUZGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H31NO6/c1-4-5-6-9-16-35-26-21-10-7-8-11-22(21)27(36-18(2)3)25-24(26)28(33)30(29(25)34)20-14-12-19(13-15-20)17-23(31)32/h7-8,10-15,18H,4-6,9,16-17H2,1-3H3,(H,31,32).
What are the key properties of 2-[4-(9-hexoxy-1,3-dioxo-4-propan-2-yloxybenzo[f]isoindol-2-yl)phenyl]acetic acid?
2-[4-(9-hexoxy-1,3-dioxo-4-propan-2-yloxybenzo[f]isoindol-2-yl)phenyl]acetic acid has a molecular weight of 489.57 g/mol, XLogP of 6.01, 11 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(9-hexoxy-1,3-dioxo-4-propan-2-yloxybenzo[f]isoindol-2-yl)phenyl]acetic acid is sourced from PubChem (CID 21079347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).