C32H28FNO6 — CID 58231513
ethyl 2-[4-(1,3-dioxo-9-phenylmethoxy-4-propan-2-yloxybenzo[f]isoindol-2-yl)-2-fluorophenyl]acetate (PubChem CID 58231513) has the molecular formula C32H28FNO6 and a molecular weight of 541.58 g/mol. Its IUPAC name is ethyl 2-[4-(1,3-dioxo-9-phenylmethoxy-4-propan-2-yloxybenzo[f]isoindol-2-yl)-2-fluorophenyl]acetate.
| Compound Name | ethyl 2-[4-(1,3-dioxo-9-phenylmethoxy-4-propan-2-yloxybenzo[f]isoindol-2-yl)-2-fluorophenyl]acetate |
|---|---|
| PubChem CID | 58231513 |
| Molecular Formula | C32H28FNO6 |
| Molecular Weight | 541.58 g/mol |
| Exact Mass | 541.19 |
| IUPAC Name | ethyl 2-[4-(1,3-dioxo-9-phenylmethoxy-4-propan-2-yloxybenzo[f]isoindol-2-yl)-2-fluorophenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(N2C(=O)c3c(c(OC(C)C)c4ccccc4c3OCc3ccccc3)C2=O)cc1F |
| InChI | InChI=1S/C32H28FNO6/c1-4-38-26(35)16-21-14-15-22(17-25(21)33)34-31(36)27-28(32(34)37)30(40-19(2)3)24-13-9-8-12-23(24)29(27)39-18-20-10-6-5-7-11-20/h5-15,17,19H,4,16,18H2,1-3H3 |
| InChIKey | JKFGSEGGPJAPSU-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.58 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|