C30H24FNO5 — CID 88563274
2-[4-(1,3-dioxo-9-phenylmethoxy-4-propan-2-yloxybenzo[f]isoindol-2-yl)-2-fluorophenyl]acetaldehyde (PubChem CID 88563274) has the molecular formula C30H24FNO5 and a molecular weight of 497.52 g/mol. Its IUPAC name is 2-[4-(1,3-dioxo-9-phenylmethoxy-4-propan-2-yloxybenzo[f]isoindol-2-yl)-2-fluorophenyl]acetaldehyde.
| Compound Name | 2-[4-(1,3-dioxo-9-phenylmethoxy-4-propan-2-yloxybenzo[f]isoindol-2-yl)-2-fluorophenyl]acetaldehyde |
|---|---|
| PubChem CID | 88563274 |
| Molecular Formula | C30H24FNO5 |
| Molecular Weight | 497.52 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | 2-[4-(1,3-dioxo-9-phenylmethoxy-4-propan-2-yloxybenzo[f]isoindol-2-yl)-2-fluorophenyl]acetaldehyde |
| SMILES | CC(C)Oc1c2c(c(OCc3ccccc3)c3ccccc13)C(=O)N(c1ccc(CC=O)c(F)c1)C2=O |
| InChI | InChI=1S/C30H24FNO5/c1-18(2)37-28-23-11-7-6-10-22(23)27(36-17-19-8-4-3-5-9-19)25-26(28)30(35)32(29(25)34)21-13-12-20(14-15-33)24(31)16-21/h3-13,15-16,18H,14,17H2,1-2H3 |
| InChIKey | CABMLVCTMRFKHZ-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.52 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|