C26H22F3NO6 — CID 58231475
ethyl 2-[4-[4-(difluoromethoxy)-1,3-dioxo-9-propan-2-yloxybenzo[f]isoindol-2-yl]-2-fluorophenyl]acetate (PubChem CID 58231475) has the molecular formula C26H22F3NO6 and a molecular weight of 501.46 g/mol. Its IUPAC name is ethyl 2-[4-[4-(difluoromethoxy)-1,3-dioxo-9-propan-2-yloxybenzo[f]isoindol-2-yl]-2-fluorophenyl]acetate.
| Compound Name | ethyl 2-[4-[4-(difluoromethoxy)-1,3-dioxo-9-propan-2-yloxybenzo[f]isoindol-2-yl]-2-fluorophenyl]acetate |
|---|---|
| PubChem CID | 58231475 |
| Molecular Formula | C26H22F3NO6 |
| Molecular Weight | 501.46 g/mol |
| Exact Mass | 501.14 |
| IUPAC Name | ethyl 2-[4-[4-(difluoromethoxy)-1,3-dioxo-9-propan-2-yloxybenzo[f]isoindol-2-yl]-2-fluorophenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(N2C(=O)c3c(c(OC(F)F)c4ccccc4c3OC(C)C)C2=O)cc1F |
| InChI | InChI=1S/C26H22F3NO6/c1-4-34-19(31)11-14-9-10-15(12-18(14)27)30-24(32)20-21(25(30)33)23(36-26(28)29)17-8-6-5-7-16(17)22(20)35-13(2)3/h5-10,12-13,26H,4,11H2,1-3H3 |
| InChIKey | IIMHRGWHQJELDO-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.46 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|