C54H56N2O9 — CID 91495428
[2-[4-(4-butoxy-3-oxo-9-propan-2-yloxy-1H-benzo[f]isoindol-2-yl)phenyl]acetyl] 2-[4-(9-butoxy-3-oxo-4-propan-2-yloxy-1H-benzo[f]isoindol-2-yl)phenyl]acetate (PubChem CID 91495428) has the molecular formula C54H56N2O9 and a molecular weight of 877.05 g/mol. Its IUPAC name is [2-[4-(4-butoxy-3-oxo-9-propan-2-yloxy-1H-benzo[f]isoindol-2-yl)phenyl]acetyl] 2-[4-(9-butoxy-3-oxo-4-propan-2-yloxy-1H-benzo[f]isoindol-2-yl)phenyl]acetate.
| Compound Name | [2-[4-(4-butoxy-3-oxo-9-propan-2-yloxy-1H-benzo[f]isoindol-2-yl)phenyl]acetyl] 2-[4-(9-butoxy-3-oxo-4-propan-2-yloxy-1H-benzo[f]isoindol-2-yl)phenyl]acetate |
|---|---|
| PubChem CID | 91495428 |
| Molecular Formula | C54H56N2O9 |
| Molecular Weight | 877.05 g/mol |
| Exact Mass | 876.40 |
| IUPAC Name | [2-[4-(4-butoxy-3-oxo-9-propan-2-yloxy-1H-benzo[f]isoindol-2-yl)phenyl]acetyl] 2-[4-(9-butoxy-3-oxo-4-propan-2-yloxy-1H-benzo[f]isoindol-2-yl)phenyl]acetate |
| SMILES | CCCCOc1c2c(c(OC(C)C)c3ccccc13)C(=O)N(c1ccc(CC(=O)OC(=O)Cc3ccc(N4Cc5c(c(OCCCC)c6ccccc6c5OC(C)C)C4=O)cc3)cc1)C2 |
| InChI | InChI=1S/C54H56N2O9/c1-7-9-27-61-49-39-15-11-14-18-42(39)52(64-34(5)6)48-43(49)31-55(54(48)60)37-23-19-35(20-24-37)29-45(57)65-46(58)30-36-21-25-38(26-22-36)56-32-44-47(53(56)59)51(62-28-10-8-2)41-17-13-12-16-40(41)50(44)63-33(3)4/h11-26,33-34H,7-10,27-32H2,1-6H3 |
| InChIKey | SXHLONBUWUGQJT-UHFFFAOYSA-N |
| XLogP | 11.10 |
| TPSA | 120.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 877.05 |
| LogP ≤ 5 | 11.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|