C25H24N2O7S — CID 10206974
N-[[4-(4,9-diethoxy-1,3-dioxobenzo[f]isoindol-2-yl)phenyl]methylsulfonyl]acetamide (PubChem CID 10206974) has the molecular formula C25H24N2O7S and a molecular weight of 496.54 g/mol. Its IUPAC name is N-[[4-(4,9-diethoxy-1,3-dioxobenzo[f]isoindol-2-yl)phenyl]methylsulfonyl]acetamide.
| Compound Name | N-[[4-(4,9-diethoxy-1,3-dioxobenzo[f]isoindol-2-yl)phenyl]methylsulfonyl]acetamide |
|---|---|
| PubChem CID | 10206974 |
| Molecular Formula | C25H24N2O7S |
| Molecular Weight | 496.54 g/mol |
| Exact Mass | 496.13 |
| IUPAC Name | N-[[4-(4,9-diethoxy-1,3-dioxobenzo[f]isoindol-2-yl)phenyl]methylsulfonyl]acetamide |
| SMILES | CCOc1c2c(c(OCC)c3ccccc13)C(=O)N(c1ccc(CS(=O)(=O)NC(C)=O)cc1)C2=O |
| InChI | InChI=1S/C25H24N2O7S/c1-4-33-22-18-8-6-7-9-19(18)23(34-5-2)21-20(22)24(29)27(25(21)30)17-12-10-16(11-13-17)14-35(31,32)26-15(3)28/h6-13H,4-5,14H2,1-3H3,(H,26,28) |
| InChIKey | CQZVUHXUSUHRMQ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.54 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|