C31H28N2O8S — CID 10210532
2-[4-(4,9-diethoxy-1,3-dioxobenzo[f]isoindol-2-yl)phenyl]-N-(3-methoxyphenyl)sulfonylacetamide (PubChem CID 10210532) has the molecular formula C31H28N2O8S and a molecular weight of 588.64 g/mol. Its IUPAC name is 2-[4-(4,9-diethoxy-1,3-dioxobenzo[f]isoindol-2-yl)phenyl]-N-(3-methoxyphenyl)sulfonylacetamide.
| Compound Name | 2-[4-(4,9-diethoxy-1,3-dioxobenzo[f]isoindol-2-yl)phenyl]-N-(3-methoxyphenyl)sulfonylacetamide |
|---|---|
| PubChem CID | 10210532 |
| Molecular Formula | C31H28N2O8S |
| Molecular Weight | 588.64 g/mol |
| Exact Mass | 588.16 |
| IUPAC Name | 2-[4-(4,9-diethoxy-1,3-dioxobenzo[f]isoindol-2-yl)phenyl]-N-(3-methoxyphenyl)sulfonylacetamide |
| SMILES | CCOc1c2c(c(OCC)c3ccccc13)C(=O)N(c1ccc(CC(=O)NS(=O)(=O)c3cccc(OC)c3)cc1)C2=O |
| InChI | InChI=1S/C31H28N2O8S/c1-4-40-28-23-11-6-7-12-24(23)29(41-5-2)27-26(28)30(35)33(31(27)36)20-15-13-19(14-16-20)17-25(34)32-42(37,38)22-10-8-9-21(18-22)39-3/h6-16,18H,4-5,17H2,1-3H3,(H,32,34) |
| InChIKey | IKUXFKAKHXDDKH-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 128.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.64 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|