C29H30ClNO6 — CID 143658080
ethyl 2-[3-chloro-4-[1-formyl-3-oxo-4,9-di(propan-2-yloxy)-1H-benzo[f]isoindol-2-yl]phenyl]acetate (PubChem CID 143658080) has the molecular formula C29H30ClNO6 and a molecular weight of 524.01 g/mol. Its IUPAC name is ethyl 2-[3-chloro-4-[1-formyl-3-oxo-4,9-di(propan-2-yloxy)-1H-benzo[f]isoindol-2-yl]phenyl]acetate.
| Compound Name | ethyl 2-[3-chloro-4-[1-formyl-3-oxo-4,9-di(propan-2-yloxy)-1H-benzo[f]isoindol-2-yl]phenyl]acetate |
|---|---|
| PubChem CID | 143658080 |
| Molecular Formula | C29H30ClNO6 |
| Molecular Weight | 524.01 g/mol |
| Exact Mass | 523.18 |
| IUPAC Name | ethyl 2-[3-chloro-4-[1-formyl-3-oxo-4,9-di(propan-2-yloxy)-1H-benzo[f]isoindol-2-yl]phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(N2C(=O)c3c(c(OC(C)C)c4ccccc4c3OC(C)C)C2C=O)c(Cl)c1 |
| InChI | InChI=1S/C29H30ClNO6/c1-6-35-24(33)14-18-11-12-22(21(30)13-18)31-23(15-32)25-26(29(31)34)28(37-17(4)5)20-10-8-7-9-19(20)27(25)36-16(2)3/h7-13,15-17,23H,6,14H2,1-5H3 |
| InChIKey | HYTHTHVBTSWCCF-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.01 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|