C27H15N3O6 — CID 118136407
4-[13-(4-aminophenyl)-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl]benzoic acid (PubChem CID 118136407) has the molecular formula C27H15N3O6 and a molecular weight of 477.43 g/mol. Its IUPAC name is 4-[13-(4-aminophenyl)-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl]benzoic acid.
| Compound Name | 4-[13-(4-aminophenyl)-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl]benzoic acid |
|---|---|
| PubChem CID | 118136407 |
| Molecular Formula | C27H15N3O6 |
| Molecular Weight | 477.43 g/mol |
| Exact Mass | 477.10 |
| IUPAC Name | 4-[13-(4-aminophenyl)-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl]benzoic acid |
| SMILES | Nc1ccc(N2C(=O)c3ccc4c5c(ccc(c35)C2=O)C(=O)N(c2ccc(C(=O)O)cc2)C4=O)cc1 |
| InChI | InChI=1S/C27H15N3O6/c28-14-3-7-16(8-4-14)30-25(33)19-11-9-17-21-18(10-12-20(22(19)21)26(30)34)24(32)29(23(17)31)15-5-1-13(2-6-15)27(35)36/h1-12H,28H2,(H,35,36) |
| InChIKey | LNNMCOUFBAMLPQ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 138.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.43 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_K(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|