C49H44N4O6S — CID 171043357
5-(4-aminophenyl)-2-[4-[4-[5-(4-aminophenyl)-1,3-dioxoisoindol-2-yl]-2,5-di(propan-2-yl)phenyl]sulfonyl-2-propan-2-ylphenyl]isoindole-1,3-dione (PubChem CID 171043357) has the molecular formula C49H44N4O6S and a molecular weight of 816.98 g/mol. Its IUPAC name is 5-(4-aminophenyl)-2-[4-[4-[5-(4-aminophenyl)-1,3-dioxoisoindol-2-yl]-2,5-di(propan-2-yl)phenyl]sulfonyl-2-propan-2-ylphenyl]isoindole-1,3-dione.
| Compound Name | 5-(4-aminophenyl)-2-[4-[4-[5-(4-aminophenyl)-1,3-dioxoisoindol-2-yl]-2,5-di(propan-2-yl)phenyl]sulfonyl-2-propan-2-ylphenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 171043357 |
| Molecular Formula | C49H44N4O6S |
| Molecular Weight | 816.98 g/mol |
| Exact Mass | 816.30 |
| IUPAC Name | 5-(4-aminophenyl)-2-[4-[4-[5-(4-aminophenyl)-1,3-dioxoisoindol-2-yl]-2,5-di(propan-2-yl)phenyl]sulfonyl-2-propan-2-ylphenyl]isoindole-1,3-dione |
| SMILES | CC(C)c1cc(S(=O)(=O)c2cc(C(C)C)c(N3C(=O)c4ccc(-c5ccc(N)cc5)cc4C3=O)cc2C(C)C)ccc1N1C(=O)c2ccc(-c3ccc(N)cc3)cc2C1=O |
| InChI | InChI=1S/C49H44N4O6S/c1-26(2)38-23-35(17-20-43(38)52-46(54)36-18-11-31(21-41(36)48(52)56)29-7-13-33(50)14-8-29)60(58,59)45-25-39(27(3)4)44(24-40(45)28(5)6)53-47(55)37-19-12-32(22-42(37)49(53)57)30-9-15-34(51)16-10-30/h7-28H,50-51H2,1-6H3 |
| InChIKey | ITFHNJZYACZMMT-UHFFFAOYSA-N |
| XLogP | 9.99 |
| TPSA | 160.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 816.98 |
| LogP ≤ 5 | 9.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|