C46H30N4O7 — CID 171043406
5-(4-aminophenyl)-2-[4-[4-[4-[5-(4-aminophenyl)-1,3-dioxoisoindol-2-yl]-3-hydroxyphenyl]-2,3-dihydroxyphenyl]phenyl]isoindole-1,3-dione (PubChem CID 171043406) has the molecular formula C46H30N4O7 and a molecular weight of 750.77 g/mol. Its IUPAC name is 5-(4-aminophenyl)-2-[4-[4-[4-[5-(4-aminophenyl)-1,3-dioxoisoindol-2-yl]-3-hydroxyphenyl]-2,3-dihydroxyphenyl]phenyl]isoindole-1,3-dione.
| Compound Name | 5-(4-aminophenyl)-2-[4-[4-[4-[5-(4-aminophenyl)-1,3-dioxoisoindol-2-yl]-3-hydroxyphenyl]-2,3-dihydroxyphenyl]phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 171043406 |
| Molecular Formula | C46H30N4O7 |
| Molecular Weight | 750.77 g/mol |
| Exact Mass | 750.21 |
| IUPAC Name | 5-(4-aminophenyl)-2-[4-[4-[4-[5-(4-aminophenyl)-1,3-dioxoisoindol-2-yl]-3-hydroxyphenyl]-2,3-dihydroxyphenyl]phenyl]isoindole-1,3-dione |
| SMILES | Nc1ccc(-c2ccc3c(c2)C(=O)N(c2ccc(-c4ccc(-c5ccc(N6C(=O)c7ccc(-c8ccc(N)cc8)cc7C6=O)c(O)c5)c(O)c4O)cc2)C3=O)cc1 |
| InChI | InChI=1S/C46H30N4O7/c47-30-10-1-24(2-11-30)27-7-16-35-37(21-27)45(56)49(43(35)54)32-14-5-26(6-15-32)33-18-19-34(42(53)41(33)52)29-9-20-39(40(51)23-29)50-44(55)36-17-8-28(22-38(36)46(50)57)25-3-12-31(48)13-4-25/h1-23,51-53H,47-48H2 |
| InChIKey | KHPXDGJXCNDKBJ-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 187.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.77 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|