C14H8Br2N2O2 — CID 107600970
5-amino-2-(2,6-dibromophenyl)isoindole-1,3-dione (PubChem CID 107600970) has the molecular formula C14H8Br2N2O2 and a molecular weight of 396.04 g/mol. Its IUPAC name is 5-amino-2-(2,6-dibromophenyl)isoindole-1,3-dione.
| Compound Name | 5-amino-2-(2,6-dibromophenyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 107600970 |
| Molecular Formula | C14H8Br2N2O2 |
| Molecular Weight | 396.04 g/mol |
| Exact Mass | 393.90 |
| IUPAC Name | 5-amino-2-(2,6-dibromophenyl)isoindole-1,3-dione |
| SMILES | Nc1ccc2c(c1)C(=O)N(c1c(Br)cccc1Br)C2=O |
| InChI | InChI=1S/C14H8Br2N2O2/c15-10-2-1-3-11(16)12(10)18-13(19)8-5-4-7(17)6-9(8)14(18)20/h1-6H,17H2 |
| InChIKey | WWMBCORZLKPRBC-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.04 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|