C16H14N2O4 — CID 86258282
5-amino-2-(3,5-dimethoxyphenyl)isoindole-1,3-dione (PubChem CID 86258282) has the molecular formula C16H14N2O4 and a molecular weight of 298.30 g/mol. Its IUPAC name is 5-amino-2-(3,5-dimethoxyphenyl)isoindole-1,3-dione.
| Compound Name | 5-amino-2-(3,5-dimethoxyphenyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 86258282 |
| Molecular Formula | C16H14N2O4 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 5-amino-2-(3,5-dimethoxyphenyl)isoindole-1,3-dione |
| SMILES | COc1cc(OC)cc(N2C(=O)c3ccc(N)cc3C2=O)c1 |
| InChI | InChI=1S/C16H14N2O4/c1-21-11-6-10(7-12(8-11)22-2)18-15(19)13-4-3-9(17)5-14(13)16(18)20/h3-8H,17H2,1-2H3 |
| InChIKey | DPUFEILFPOPQGV-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|