C38H28N2O6 — CID 162769383
2-[2,3-dimethoxy-4-[5-(4-methylphenyl)-1,3-dioxoisoindol-2-yl]phenyl]-5-(4-methylphenyl)isoindole-1,3-dione (PubChem CID 162769383) has the molecular formula C38H28N2O6 and a molecular weight of 608.65 g/mol. Its IUPAC name is 2-[2,3-dimethoxy-4-[5-(4-methylphenyl)-1,3-dioxoisoindol-2-yl]phenyl]-5-(4-methylphenyl)isoindole-1,3-dione.
| Compound Name | 2-[2,3-dimethoxy-4-[5-(4-methylphenyl)-1,3-dioxoisoindol-2-yl]phenyl]-5-(4-methylphenyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 162769383 |
| Molecular Formula | C38H28N2O6 |
| Molecular Weight | 608.65 g/mol |
| Exact Mass | 608.19 |
| IUPAC Name | 2-[2,3-dimethoxy-4-[5-(4-methylphenyl)-1,3-dioxoisoindol-2-yl]phenyl]-5-(4-methylphenyl)isoindole-1,3-dione |
| SMILES | COc1c(N2C(=O)c3ccc(-c4ccc(C)cc4)cc3C2=O)ccc(N2C(=O)c3ccc(-c4ccc(C)cc4)cc3C2=O)c1OC |
| InChI | InChI=1S/C38H28N2O6/c1-21-5-9-23(10-6-21)25-13-15-27-29(19-25)37(43)39(35(27)41)31-17-18-32(34(46-4)33(31)45-3)40-36(42)28-16-14-26(20-30(28)38(40)44)24-11-7-22(2)8-12-24/h5-20H,1-4H3 |
| InChIKey | KZNGSXNMNKUWJT-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.65 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|